- +86 0371-86658258
- info@coreychem.com
English
| 4,4′-Thiodibenzenethiol Chemical Properties | |
| Melting point | 112-114 °C(lit.) |
| Boiling point | 148 °C / 12mmHg |
| density | 1.30±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 5.86±0.10(Predicted) |
| color | White to Pale Yellow |
| InChI | InChI=1S/C12H10S3/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8,13-14H |
| InChIKey | JLLMOYPIVVKFHY-UHFFFAOYSA-N |
| SMILES | S(C1=CC=C(S)C=C1)C1=CC=C(S)C=C1 |
| Safety Information | |
| Purity | 98% |
| Hazard Codes | non-hazardous goods |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2930909099 |
| 4,4′-Thiodibenzenethiol Usage | |
| Uses | intermedia |
| Uses | 4,4′-Thiobisbenzenethiol acts as a reducing agent, and affects the catalytic activity of caspase-3 protein. |
| Uses | 4,4”-Thiobisbenzenethiol acts as a reducing agent, and affects the catalytic activity of caspase-3 protein. |
| Contact person: | Crystal@coreychem.com |
1.Packing: 1Kg;5Kg;10Kg/25kg/bag or according to the customer’s requirements
